C24H38ClNO4Si — CID 102250869
(3aR,5R,9R,10aR)-7-benzyl-9-[tert-butyl(dimethyl)silyl]oxy-5-chloro-2,2-dimethyl-4,5,8,9,10,10a-hexahydro-3aH-[1,3]dioxolo[4,5-e]azonin-6-one (PubChem CID 102250869) has the molecular formula C24H38ClNO4Si and a molecular weight of 468.11 g/mol. Its IUPAC name is (3aR,5R,9R,10aR)-7-benzyl-9-[tert-butyl(dimethyl)silyl]oxy-5-chloro-2,2-dimethyl-4,5,8,9,10,10a-hexahydro-3aH-[1,3]dioxolo[4,5-e]azonin-6-one.
| Compound Name | (3aR,5R,9R,10aR)-7-benzyl-9-[tert-butyl(dimethyl)silyl]oxy-5-chloro-2,2-dimethyl-4,5,8,9,10,10a-hexahydro-3aH-[1,3]dioxolo[4,5-e]azonin-6-one |
|---|---|
| PubChem CID | 102250869 |
| Molecular Formula | C24H38ClNO4Si |
| Molecular Weight | 468.11 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | (3aR,5R,9R,10aR)-7-benzyl-9-[tert-butyl(dimethyl)silyl]oxy-5-chloro-2,2-dimethyl-4,5,8,9,10,10a-hexahydro-3aH-[1,3]dioxolo[4,5-e]azonin-6-one |
| SMILES | CC1(C)O[C@@H]2C[C@@H](O[Si](C)(C)C(C)(C)C)CN(Cc3ccccc3)C(=O)[C@H](Cl)C[C@H]2O1 |
| InChI | InChI=1S/C24H38ClNO4Si/c1-23(2,3)31(6,7)30-18-13-20-21(29-24(4,5)28-20)14-19(25)22(27)26(16-18)15-17-11-9-8-10-12-17/h8-12,18-21H,13-16H2,1-7H3/t18-,19-,20-,21-/m1/s1 |
| InChIKey | REQCXFKAPHARHH-XRXFAXGQSA-N |
| XLogP | 5.33 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.11 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|