C21H34ClNO4Si — CID 102250867
(3R,5R,6R,8R)-1-benzyl-8-[tert-butyl(dimethyl)silyl]oxy-3-chloro-5,6-dihydroxyazonan-2-one (PubChem CID 102250867) has the molecular formula C21H34ClNO4Si and a molecular weight of 428.05 g/mol. Its IUPAC name is (3R,5R,6R,8R)-1-benzyl-8-[tert-butyl(dimethyl)silyl]oxy-3-chloro-5,6-dihydroxyazonan-2-one.
| Compound Name | (3R,5R,6R,8R)-1-benzyl-8-[tert-butyl(dimethyl)silyl]oxy-3-chloro-5,6-dihydroxyazonan-2-one |
|---|---|
| PubChem CID | 102250867 |
| Molecular Formula | C21H34ClNO4Si |
| Molecular Weight | 428.05 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | (3R,5R,6R,8R)-1-benzyl-8-[tert-butyl(dimethyl)silyl]oxy-3-chloro-5,6-dihydroxyazonan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@@H](O)[C@H](O)C[C@@H](Cl)C(=O)N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C21H34ClNO4Si/c1-21(2,3)28(4,5)27-16-11-18(24)19(25)12-17(22)20(26)23(14-16)13-15-9-7-6-8-10-15/h6-10,16-19,24-25H,11-14H2,1-5H3/t16-,17-,18-,19-/m1/s1 |
| InChIKey | JPDTUVQHOPRSCS-NCXUSEDFSA-N |
| XLogP | 3.53 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.05 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|