C27H39NO4Si — CID 11442765
(3S,5R,6R,8R)-1-benzyl-8-[tert-butyl(dimethyl)silyl]oxy-5,6-dihydroxy-3-phenylazonan-2-one (PubChem CID 11442765) has the molecular formula C27H39NO4Si and a molecular weight of 469.70 g/mol. Its IUPAC name is (3S,5R,6R,8R)-1-benzyl-8-[tert-butyl(dimethyl)silyl]oxy-5,6-dihydroxy-3-phenylazonan-2-one.
| Compound Name | (3S,5R,6R,8R)-1-benzyl-8-[tert-butyl(dimethyl)silyl]oxy-5,6-dihydroxy-3-phenylazonan-2-one |
|---|---|
| PubChem CID | 11442765 |
| Molecular Formula | C27H39NO4Si |
| Molecular Weight | 469.70 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | (3S,5R,6R,8R)-1-benzyl-8-[tert-butyl(dimethyl)silyl]oxy-5,6-dihydroxy-3-phenylazonan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@@H](O)[C@H](O)C[C@@H](c2ccccc2)C(=O)N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C27H39NO4Si/c1-27(2,3)33(4,5)32-22-16-24(29)25(30)17-23(21-14-10-7-11-15-21)26(31)28(19-22)18-20-12-8-6-9-13-20/h6-15,22-25,29-30H,16-19H2,1-5H3/t22-,23+,24-,25-/m1/s1 |
| InChIKey | BKSZWKMCTGWXKG-ZFFYZDHPSA-N |
| XLogP | 4.70 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.70 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|