C30H43NO4Si — CID 102250868
(3aR,5S,9R,10aR)-7-benzyl-9-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-5-phenyl-4,5,8,9,10,10a-hexahydro-3aH-[1,3]dioxolo[4,5-e]azonin-6-one (PubChem CID 102250868) has the molecular formula C30H43NO4Si and a molecular weight of 509.76 g/mol. Its IUPAC name is (3aR,5S,9R,10aR)-7-benzyl-9-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-5-phenyl-4,5,8,9,10,10a-hexahydro-3aH-[1,3]dioxolo[4,5-e]azonin-6-one.
| Compound Name | (3aR,5S,9R,10aR)-7-benzyl-9-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-5-phenyl-4,5,8,9,10,10a-hexahydro-3aH-[1,3]dioxolo[4,5-e]azonin-6-one |
|---|---|
| PubChem CID | 102250868 |
| Molecular Formula | C30H43NO4Si |
| Molecular Weight | 509.76 g/mol |
| Exact Mass | 509.30 |
| IUPAC Name | (3aR,5S,9R,10aR)-7-benzyl-9-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-5-phenyl-4,5,8,9,10,10a-hexahydro-3aH-[1,3]dioxolo[4,5-e]azonin-6-one |
| SMILES | CC1(C)O[C@@H]2C[C@@H](O[Si](C)(C)C(C)(C)C)CN(Cc3ccccc3)C(=O)[C@H](c3ccccc3)C[C@H]2O1 |
| InChI | InChI=1S/C30H43NO4Si/c1-29(2,3)36(6,7)35-24-18-26-27(34-30(4,5)33-26)19-25(23-16-12-9-13-17-23)28(32)31(21-24)20-22-14-10-8-11-15-22/h8-17,24-27H,18-21H2,1-7H3/t24-,25+,26-,27-/m1/s1 |
| InChIKey | NOCQIOYWVNAJOI-HVWQDESWSA-N |
| XLogP | 6.50 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.76 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|