C27H39NO2Si — CID 102250856
(3S,8R)-1-benzyl-8-[tert-butyl(dimethyl)silyl]oxy-3-phenylazonan-2-one (PubChem CID 102250856) has the molecular formula C27H39NO2Si and a molecular weight of 437.70 g/mol. Its IUPAC name is (3S,8R)-1-benzyl-8-[tert-butyl(dimethyl)silyl]oxy-3-phenylazonan-2-one.
| Compound Name | (3S,8R)-1-benzyl-8-[tert-butyl(dimethyl)silyl]oxy-3-phenylazonan-2-one |
|---|---|
| PubChem CID | 102250856 |
| Molecular Formula | C27H39NO2Si |
| Molecular Weight | 437.70 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | (3S,8R)-1-benzyl-8-[tert-butyl(dimethyl)silyl]oxy-3-phenylazonan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CCCC[C@@H](c2ccccc2)C(=O)N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C27H39NO2Si/c1-27(2,3)31(4,5)30-24-18-12-13-19-25(23-16-10-7-11-17-23)26(29)28(21-24)20-22-14-8-6-9-15-22/h6-11,14-17,24-25H,12-13,18-21H2,1-5H3/t24-,25+/m1/s1 |
| InChIKey | IAFACEFVAQDKRG-RPBOFIJWSA-N |
| XLogP | 6.76 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.70 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|