C22H33NO2Si — CID 101353406
(3R,4S)-4-[1-[tert-butyl(dimethyl)silyl]oxybut-3-enyl]-3-phenyl-1-prop-2-enylazetidin-2-one (PubChem CID 101353406) has the molecular formula C22H33NO2Si and a molecular weight of 371.60 g/mol. Its IUPAC name is (3R,4S)-4-[1-[tert-butyl(dimethyl)silyl]oxybut-3-enyl]-3-phenyl-1-prop-2-enylazetidin-2-one.
| Compound Name | (3R,4S)-4-[1-[tert-butyl(dimethyl)silyl]oxybut-3-enyl]-3-phenyl-1-prop-2-enylazetidin-2-one |
|---|---|
| PubChem CID | 101353406 |
| Molecular Formula | C22H33NO2Si |
| Molecular Weight | 371.60 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | (3R,4S)-4-[1-[tert-butyl(dimethyl)silyl]oxybut-3-enyl]-3-phenyl-1-prop-2-enylazetidin-2-one |
| SMILES | C=CCC(O[Si](C)(C)C(C)(C)C)[C@@H]1[C@@H](c2ccccc2)C(=O)N1CC=C |
| InChI | InChI=1S/C22H33NO2Si/c1-8-13-18(25-26(6,7)22(3,4)5)20-19(17-14-11-10-12-15-17)21(24)23(20)16-9-2/h8-12,14-15,18-20H,1-2,13,16H2,3-7H3/t18?,19-,20-/m1/s1 |
| InChIKey | MQTDVOJSDDRQRT-FXJNCMGBSA-N |
| XLogP | 5.13 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.60 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|