C18H27NO3Si — CID 135070019
(3S,4R)-1-acetyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylazetidin-2-one (PubChem CID 135070019) has the molecular formula C18H27NO3Si and a molecular weight of 333.50 g/mol. Its IUPAC name is (3S,4R)-1-acetyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylazetidin-2-one.
| Compound Name | (3S,4R)-1-acetyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylazetidin-2-one |
|---|---|
| PubChem CID | 135070019 |
| Molecular Formula | C18H27NO3Si |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | (3S,4R)-1-acetyl-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-phenylazetidin-2-one |
| SMILES | CC(=O)N1C(=O)[C@@H](c2ccccc2)[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H27NO3Si/c1-13(20)19-15(12-22-23(5,6)18(2,3)4)16(17(19)21)14-10-8-7-9-11-14/h7-11,15-16H,12H2,1-6H3/t15-,16-/m0/s1 |
| InChIKey | MBWSCBNXJCHQMB-HOTGVXAUSA-N |
| XLogP | 3.55 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|