C26H41NO2Si — CID 134981749
(3S,4S)-1-[tert-butyl(dimethyl)silyl]-4-[(1E,3E,5R,6R)-6-methoxy-3,5-dimethyl-7-phenylhepta-1,3-dienyl]-3-methylazetidin-2-one (PubChem CID 134981749) has the molecular formula C26H41NO2Si and a molecular weight of 427.71 g/mol. Its IUPAC name is (3S,4S)-1-[tert-butyl(dimethyl)silyl]-4-[(1E,3E,5R,6R)-6-methoxy-3,5-dimethyl-7-phenylhepta-1,3-dienyl]-3-methylazetidin-2-one.
| Compound Name | (3S,4S)-1-[tert-butyl(dimethyl)silyl]-4-[(1E,3E,5R,6R)-6-methoxy-3,5-dimethyl-7-phenylhepta-1,3-dienyl]-3-methylazetidin-2-one |
|---|---|
| PubChem CID | 134981749 |
| Molecular Formula | C26H41NO2Si |
| Molecular Weight | 427.71 g/mol |
| Exact Mass | 427.29 |
| IUPAC Name | (3S,4S)-1-[tert-butyl(dimethyl)silyl]-4-[(1E,3E,5R,6R)-6-methoxy-3,5-dimethyl-7-phenylhepta-1,3-dienyl]-3-methylazetidin-2-one |
| SMILES | CO[C@H](Cc1ccccc1)[C@H](C)/C=C(C)/C=C/[C@H]1[C@H](C)C(=O)N1[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H41NO2Si/c1-19(17-20(2)24(29-7)18-22-13-11-10-12-14-22)15-16-23-21(3)25(28)27(23)30(8,9)26(4,5)6/h10-17,20-21,23-24H,18H2,1-9H3/b16-15+,19-17+/t20-,21+,23+,24-/m1/s1 |
| InChIKey | AJZHYSVSEJZWFF-SUUIWDMFSA-N |
| XLogP | 6.23 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.71 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|