C35H61NO2Si — CID 163319724
(Z,2R)-N-benzyl-N-[(E,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-ethyl-8-methyldec-8-enyl]-2-ethylhept-5-enamide (PubChem CID 163319724) has the molecular formula C35H61NO2Si and a molecular weight of 555.96 g/mol. Its IUPAC name is (Z,2R)-N-benzyl-N-[(E,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-ethyl-8-methyldec-8-enyl]-2-ethylhept-5-enamide.
| Compound Name | (Z,2R)-N-benzyl-N-[(E,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-ethyl-8-methyldec-8-enyl]-2-ethylhept-5-enamide |
|---|---|
| PubChem CID | 163319724 |
| Molecular Formula | C35H61NO2Si |
| Molecular Weight | 555.96 g/mol |
| Exact Mass | 555.45 |
| IUPAC Name | (Z,2R)-N-benzyl-N-[(E,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-ethyl-8-methyldec-8-enyl]-2-ethylhept-5-enamide |
| SMILES | C/C=C\CC[C@@H](CC)C(=O)N(CCC[C@@H](CC)[C@@H](CC/C(C)=C/C)O[Si](C)(C)C(C)(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C35H61NO2Si/c1-11-15-17-23-32(14-4)34(37)36(28-30-21-18-16-19-22-30)27-20-24-31(13-3)33(26-25-29(5)12-2)38-39(9,10)35(6,7)8/h11-12,15-16,18-19,21-22,31-33H,13-14,17,20,23-28H2,1-10H3/b15-11-,29-12+/t31-,32-,33-/m1/s1 |
| InChIKey | CKYGQBPKQOSOQV-NJFVOMPUSA-N |
| XLogP | 10.34 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.96 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|