C31H53NO2Si — CID 163319725
(3R,6E,10R,11R)-1-benzyl-10-[tert-butyl(dimethyl)silyl]oxy-3,11-diethyl-7-methyl-1-azacyclotetradec-6-en-2-one (PubChem CID 163319725) has the molecular formula C31H53NO2Si and a molecular weight of 499.86 g/mol. Its IUPAC name is (3R,6E,10R,11R)-1-benzyl-10-[tert-butyl(dimethyl)silyl]oxy-3,11-diethyl-7-methyl-1-azacyclotetradec-6-en-2-one.
| Compound Name | (3R,6E,10R,11R)-1-benzyl-10-[tert-butyl(dimethyl)silyl]oxy-3,11-diethyl-7-methyl-1-azacyclotetradec-6-en-2-one |
|---|---|
| PubChem CID | 163319725 |
| Molecular Formula | C31H53NO2Si |
| Molecular Weight | 499.86 g/mol |
| Exact Mass | 499.38 |
| IUPAC Name | (3R,6E,10R,11R)-1-benzyl-10-[tert-butyl(dimethyl)silyl]oxy-3,11-diethyl-7-methyl-1-azacyclotetradec-6-en-2-one |
| SMILES | CC[C@@H]1CC/C=C(\C)CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](CC)CCCN(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C31H53NO2Si/c1-9-27-20-15-23-32(24-26-17-12-11-13-18-26)30(33)28(10-2)19-14-16-25(3)21-22-29(27)34-35(7,8)31(4,5)6/h11-13,16-18,27-29H,9-10,14-15,19-24H2,1-8H3/b25-16+/t27-,28-,29-/m1/s1 |
| InChIKey | HGYZFCMKKGJYKX-LVNTZZMWSA-N |
| XLogP | 8.76 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.86 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|