C26H45NO2Si — CID 134917964
(2R)-N-[(1R)-1-phenylethyl]-2-[(1S)-1-tri(propan-2-yl)silyloxyprop-2-enyl]hexanamide (PubChem CID 134917964) has the molecular formula C26H45NO2Si and a molecular weight of 431.74 g/mol. Its IUPAC name is (2R)-N-[(1R)-1-phenylethyl]-2-[(1S)-1-tri(propan-2-yl)silyloxyprop-2-enyl]hexanamide.
| Compound Name | (2R)-N-[(1R)-1-phenylethyl]-2-[(1S)-1-tri(propan-2-yl)silyloxyprop-2-enyl]hexanamide |
|---|---|
| PubChem CID | 134917964 |
| Molecular Formula | C26H45NO2Si |
| Molecular Weight | 431.74 g/mol |
| Exact Mass | 431.32 |
| IUPAC Name | (2R)-N-[(1R)-1-phenylethyl]-2-[(1S)-1-tri(propan-2-yl)silyloxyprop-2-enyl]hexanamide |
| SMILES | C=C[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](CCCC)C(=O)N[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C26H45NO2Si/c1-10-12-18-24(26(28)27-22(9)23-16-14-13-15-17-23)25(11-2)29-30(19(3)4,20(5)6)21(7)8/h11,13-17,19-22,24-25H,2,10,12,18H2,1,3-9H3,(H,27,28)/t22-,24-,25+/m1/s1 |
| InChIKey | SPUKIXWRLXZSAS-GPXOXTDOSA-N |
| XLogP | 7.42 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.74 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|