C22H37NO2Si2 — CID 15447303
N-[2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethyl]-5-trimethylsilylpent-4-ynamide (PubChem CID 15447303) has the molecular formula C22H37NO2Si2 and a molecular weight of 403.72 g/mol. Its IUPAC name is N-[2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethyl]-5-trimethylsilylpent-4-ynamide.
| Compound Name | N-[2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethyl]-5-trimethylsilylpent-4-ynamide |
|---|---|
| PubChem CID | 15447303 |
| Molecular Formula | C22H37NO2Si2 |
| Molecular Weight | 403.72 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | N-[2-[tert-butyl(dimethyl)silyl]oxy-1-phenylethyl]-5-trimethylsilylpent-4-ynamide |
| SMILES | CC(C)(C)[Si](C)(C)OCC(NC(=O)CCC#C[Si](C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C22H37NO2Si2/c1-22(2,3)27(7,8)25-18-20(19-14-10-9-11-15-19)23-21(24)16-12-13-17-26(4,5)6/h9-11,14-15,20H,12,16,18H2,1-8H3,(H,23,24) |
| InChIKey | GZTLYAWSOBDINV-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.72 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|