C18H29NO2Si2 — CID 10641415
(2S)-4-oxo-N-[(1R)-1-phenylethyl]-2,3-bis(trimethylsilyl)but-3-enamide (PubChem CID 10641415) has the molecular formula C18H29NO2Si2 and a molecular weight of 347.61 g/mol. Its IUPAC name is (2S)-4-oxo-N-[(1R)-1-phenylethyl]-2,3-bis(trimethylsilyl)but-3-enamide.
| Compound Name | (2S)-4-oxo-N-[(1R)-1-phenylethyl]-2,3-bis(trimethylsilyl)but-3-enamide |
|---|---|
| PubChem CID | 10641415 |
| Molecular Formula | C18H29NO2Si2 |
| Molecular Weight | 347.61 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | (2S)-4-oxo-N-[(1R)-1-phenylethyl]-2,3-bis(trimethylsilyl)but-3-enamide |
| SMILES | C[C@@H](NC(=O)[C@@H](C(=C=O)[Si](C)(C)C)[Si](C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C18H29NO2Si2/c1-14(15-11-9-8-10-12-15)19-18(21)17(23(5,6)7)16(13-20)22(2,3)4/h8-12,14,17H,1-7H3,(H,19,21)/t14-,17-/m1/s1 |
| InChIKey | GFUHOLIPAWXWSS-RHSMWYFYSA-N |
| XLogP | 4.21 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.61 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|