C21H35NO2Si — CID 162416997
(3S)-1-benzyl-3-[4-[tert-butyl(dimethyl)silyl]oxybutyl]pyrrolidin-2-one (PubChem CID 162416997) has the molecular formula C21H35NO2Si and a molecular weight of 361.60 g/mol. Its IUPAC name is (3S)-1-benzyl-3-[4-[tert-butyl(dimethyl)silyl]oxybutyl]pyrrolidin-2-one.
| Compound Name | (3S)-1-benzyl-3-[4-[tert-butyl(dimethyl)silyl]oxybutyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 162416997 |
| Molecular Formula | C21H35NO2Si |
| Molecular Weight | 361.60 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | (3S)-1-benzyl-3-[4-[tert-butyl(dimethyl)silyl]oxybutyl]pyrrolidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OCCCC[C@H]1CCN(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C21H35NO2Si/c1-21(2,3)25(4,5)24-16-10-9-13-19-14-15-22(20(19)23)17-18-11-7-6-8-12-18/h6-8,11-12,19H,9-10,13-17H2,1-5H3/t19-/m0/s1 |
| InChIKey | FSDTUORFRBCDSY-IBGZPJMESA-N |
| XLogP | 5.23 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.60 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|