C34H51NO2Si — CID 135078248
N,N-dibenzyl-2-[(1R,2R,5S)-2-but-3-enyl-5-tri(propan-2-yl)silyloxycyclopentyl]acetamide (PubChem CID 135078248) has the molecular formula C34H51NO2Si and a molecular weight of 533.87 g/mol. Its IUPAC name is N,N-dibenzyl-2-[(1R,2R,5S)-2-but-3-enyl-5-tri(propan-2-yl)silyloxycyclopentyl]acetamide.
| Compound Name | N,N-dibenzyl-2-[(1R,2R,5S)-2-but-3-enyl-5-tri(propan-2-yl)silyloxycyclopentyl]acetamide |
|---|---|
| PubChem CID | 135078248 |
| Molecular Formula | C34H51NO2Si |
| Molecular Weight | 533.87 g/mol |
| Exact Mass | 533.37 |
| IUPAC Name | N,N-dibenzyl-2-[(1R,2R,5S)-2-but-3-enyl-5-tri(propan-2-yl)silyloxycyclopentyl]acetamide |
| SMILES | C=CCC[C@@H]1CC[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H]1CC(=O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C34H51NO2Si/c1-8-9-20-31-21-22-33(37-38(26(2)3,27(4)5)28(6)7)32(31)23-34(36)35(24-29-16-12-10-13-17-29)25-30-18-14-11-15-19-30/h8,10-19,26-28,31-33H,1,9,20-25H2,2-7H3/t31-,32-,33+/m1/s1 |
| InChIKey | VTRGNLCZTIBMDR-SLGZMBILSA-N |
| XLogP | 9.16 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.87 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|