C26H37NO2Si — CID 173284781
1,3-dibenzyl-3-(2-dimethylsilyloxy-3,3-dimethylbutyl)pyrrolidin-2-one (PubChem CID 173284781) has the molecular formula C26H37NO2Si and a molecular weight of 423.67 g/mol. Its IUPAC name is 1,3-dibenzyl-3-(2-dimethylsilyloxy-3,3-dimethylbutyl)pyrrolidin-2-one.
| Compound Name | 1,3-dibenzyl-3-(2-dimethylsilyloxy-3,3-dimethylbutyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 173284781 |
| Molecular Formula | C26H37NO2Si |
| Molecular Weight | 423.67 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | 1,3-dibenzyl-3-(2-dimethylsilyloxy-3,3-dimethylbutyl)pyrrolidin-2-one |
| SMILES | C[SiH](C)OC(CC1(Cc2ccccc2)CCN(Cc2ccccc2)C1=O)C(C)(C)C |
| InChI | InChI=1S/C26H37NO2Si/c1-25(2,3)23(29-30(4)5)19-26(18-21-12-8-6-9-13-21)16-17-27(24(26)28)20-22-14-10-7-11-15-22/h6-15,23,30H,16-20H2,1-5H3 |
| InChIKey | WQXDADXZGRRDLW-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.67 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|