C27H37NO3Si — CID 102250870
(1S,3S,7R,9S)-5-benzyl-7-[tert-butyl(dimethyl)silyl]oxy-3-phenyl-10-oxa-5-azabicyclo[7.1.0]decan-4-one (PubChem CID 102250870) has the molecular formula C27H37NO3Si and a molecular weight of 451.68 g/mol. Its IUPAC name is (1S,3S,7R,9S)-5-benzyl-7-[tert-butyl(dimethyl)silyl]oxy-3-phenyl-10-oxa-5-azabicyclo[7.1.0]decan-4-one.
| Compound Name | (1S,3S,7R,9S)-5-benzyl-7-[tert-butyl(dimethyl)silyl]oxy-3-phenyl-10-oxa-5-azabicyclo[7.1.0]decan-4-one |
|---|---|
| PubChem CID | 102250870 |
| Molecular Formula | C27H37NO3Si |
| Molecular Weight | 451.68 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | (1S,3S,7R,9S)-5-benzyl-7-[tert-butyl(dimethyl)silyl]oxy-3-phenyl-10-oxa-5-azabicyclo[7.1.0]decan-4-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@@H]2O[C@H]2C[C@@H](c2ccccc2)C(=O)N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C27H37NO3Si/c1-27(2,3)32(4,5)31-22-16-24-25(30-24)17-23(21-14-10-7-11-15-21)26(29)28(19-22)18-20-12-8-6-9-13-20/h6-15,22-25H,16-19H2,1-5H3/t22-,23+,24+,25+/m1/s1 |
| InChIKey | NARJCHSGOAYNDK-ROHNOIKCSA-N |
| XLogP | 5.75 |
| TPSA | 42.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.68 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|