C30H41NO4Si — CID 122227065
ethyl (3R,5E,7S,8S)-1-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-9-oxo-8-phenyl-3,4,7,8-tetrahydro-2H-azonine-7-carboxylate (PubChem CID 122227065) has the molecular formula C30H41NO4Si and a molecular weight of 507.75 g/mol. Its IUPAC name is ethyl (3R,5E,7S,8S)-1-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-9-oxo-8-phenyl-3,4,7,8-tetrahydro-2H-azonine-7-carboxylate.
| Compound Name | ethyl (3R,5E,7S,8S)-1-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-9-oxo-8-phenyl-3,4,7,8-tetrahydro-2H-azonine-7-carboxylate |
|---|---|
| PubChem CID | 122227065 |
| Molecular Formula | C30H41NO4Si |
| Molecular Weight | 507.75 g/mol |
| Exact Mass | 507.28 |
| IUPAC Name | ethyl (3R,5E,7S,8S)-1-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-9-oxo-8-phenyl-3,4,7,8-tetrahydro-2H-azonine-7-carboxylate |
| SMILES | CCOC(=O)[C@H]1/C=C/C[C@@H](O[Si](C)(C)C(C)(C)C)CN(Cc2ccccc2)C(=O)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C30H41NO4Si/c1-7-34-29(33)26-20-14-19-25(35-36(5,6)30(2,3)4)22-31(21-23-15-10-8-11-16-23)28(32)27(26)24-17-12-9-13-18-24/h8-18,20,25-27H,7,19,21-22H2,1-6H3/b20-14+/t25-,26+,27-/m1/s1 |
| InChIKey | GIYQDPFQXAXNKS-OMCMXRTCSA-N |
| XLogP | 6.33 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.75 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|