C28H39NO4Si — CID 134903062
(4R)-3-[(3R)-7-[tert-butyl(dimethyl)silyl]oxy-3-phenylheptanoyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 134903062) has the molecular formula C28H39NO4Si and a molecular weight of 481.71 g/mol. Its IUPAC name is (4R)-3-[(3R)-7-[tert-butyl(dimethyl)silyl]oxy-3-phenylheptanoyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-[(3R)-7-[tert-butyl(dimethyl)silyl]oxy-3-phenylheptanoyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 134903062 |
| Molecular Formula | C28H39NO4Si |
| Molecular Weight | 481.71 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | (4R)-3-[(3R)-7-[tert-butyl(dimethyl)silyl]oxy-3-phenylheptanoyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OCCCC[C@H](CC(=O)N1C(=O)OC[C@H]1c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H39NO4Si/c1-28(2,3)34(4,5)33-19-13-12-18-24(22-14-8-6-9-15-22)20-26(30)29-25(21-32-27(29)31)23-16-10-7-11-17-23/h6-11,14-17,24-25H,12-13,18-21H2,1-5H3/t24-,25+/m1/s1 |
| InChIKey | VVSXDIQDIYBNOC-RPBOFIJWSA-N |
| XLogP | 7.07 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.71 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|