C26H36N2O3Si2 — CID 15511548
(4S)-3-[(3R)-3-benzyl-1-[bis(trimethylsilyl)methyl]-2-oxoazetidin-3-yl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 15511548) has the molecular formula C26H36N2O3Si2 and a molecular weight of 480.76 g/mol. Its IUPAC name is (4S)-3-[(3R)-3-benzyl-1-[bis(trimethylsilyl)methyl]-2-oxoazetidin-3-yl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(3R)-3-benzyl-1-[bis(trimethylsilyl)methyl]-2-oxoazetidin-3-yl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 15511548 |
| Molecular Formula | C26H36N2O3Si2 |
| Molecular Weight | 480.76 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | (4S)-3-[(3R)-3-benzyl-1-[bis(trimethylsilyl)methyl]-2-oxoazetidin-3-yl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | C[Si](C)(C)C(N1C[C@@](Cc2ccccc2)(N2C(=O)OC[C@@H]2c2ccccc2)C1=O)[Si](C)(C)C |
| InChI | InChI=1S/C26H36N2O3Si2/c1-32(2,3)25(33(4,5)6)27-19-26(23(27)29,17-20-13-9-7-10-14-20)28-22(18-31-24(28)30)21-15-11-8-12-16-21/h7-16,22,25H,17-19H2,1-6H3/t22-,26-/m1/s1 |
| InChIKey | SWPDGSWVMTUTFJ-ATIYNZHBSA-N |
| XLogP | 5.13 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.76 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|