C21H34N2O3Si2 — CID 15511544
(4S)-3-[(3R)-1-[bis(trimethylsilyl)methyl]-3-ethyl-2-oxoazetidin-3-yl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 15511544) has the molecular formula C21H34N2O3Si2 and a molecular weight of 418.69 g/mol. Its IUPAC name is (4S)-3-[(3R)-1-[bis(trimethylsilyl)methyl]-3-ethyl-2-oxoazetidin-3-yl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(3R)-1-[bis(trimethylsilyl)methyl]-3-ethyl-2-oxoazetidin-3-yl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 15511544 |
| Molecular Formula | C21H34N2O3Si2 |
| Molecular Weight | 418.69 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | (4S)-3-[(3R)-1-[bis(trimethylsilyl)methyl]-3-ethyl-2-oxoazetidin-3-yl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | CC[C@@]1(N2C(=O)OC[C@@H]2c2ccccc2)CN(C([Si](C)(C)C)[Si](C)(C)C)C1=O |
| InChI | InChI=1S/C21H34N2O3Si2/c1-8-21(15-22(18(21)24)20(27(2,3)4)28(5,6)7)23-17(14-26-19(23)25)16-12-10-9-11-13-16/h9-13,17,20H,8,14-15H2,1-7H3/t17-,21-/m1/s1 |
| InChIKey | AZTATHZNFKILBN-DYESRHJHSA-N |
| XLogP | 4.29 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.69 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|