C28H39NO4Si — CID 11049133
ethyl 2-[(2S,3S,4R)-1-benzyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-4-phenylpyrrolidin-3-yl]acetate (PubChem CID 11049133) has the molecular formula C28H39NO4Si and a molecular weight of 481.71 g/mol. Its IUPAC name is ethyl 2-[(2S,3S,4R)-1-benzyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-4-phenylpyrrolidin-3-yl]acetate.
| Compound Name | ethyl 2-[(2S,3S,4R)-1-benzyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-4-phenylpyrrolidin-3-yl]acetate |
|---|---|
| PubChem CID | 11049133 |
| Molecular Formula | C28H39NO4Si |
| Molecular Weight | 481.71 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | ethyl 2-[(2S,3S,4R)-1-benzyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxo-4-phenylpyrrolidin-3-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1[C@@H](CO[Si](C)(C)C(C)(C)C)N(Cc2ccccc2)C(=O)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C28H39NO4Si/c1-7-32-25(30)18-23-24(20-33-34(5,6)28(2,3)4)29(19-21-14-10-8-11-15-21)27(31)26(23)22-16-12-9-13-17-22/h8-17,23-24,26H,7,18-20H2,1-6H3/t23-,24-,26+/m1/s1 |
| InChIKey | JHCHRYYEBWALER-MZKUHISZSA-N |
| XLogP | 5.77 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.71 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|