C22H33Cl2NO4Si — CID 134847689
ethyl 2-[(2R,3S)-1-benzyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,4-dichloro-5-oxopyrrolidin-3-yl]acetate (PubChem CID 134847689) has the molecular formula C22H33Cl2NO4Si and a molecular weight of 474.50 g/mol. Its IUPAC name is ethyl 2-[(2R,3S)-1-benzyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,4-dichloro-5-oxopyrrolidin-3-yl]acetate.
| Compound Name | ethyl 2-[(2R,3S)-1-benzyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,4-dichloro-5-oxopyrrolidin-3-yl]acetate |
|---|---|
| PubChem CID | 134847689 |
| Molecular Formula | C22H33Cl2NO4Si |
| Molecular Weight | 474.50 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | ethyl 2-[(2R,3S)-1-benzyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,4-dichloro-5-oxopyrrolidin-3-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1[C@H](CO[Si](C)(C)C(C)(C)C)N(Cc2ccccc2)C(=O)C1(Cl)Cl |
| InChI | InChI=1S/C22H33Cl2NO4Si/c1-7-28-19(26)13-17-18(15-29-30(5,6)21(2,3)4)25(20(27)22(17,23)24)14-16-11-9-8-10-12-16/h8-12,17-18H,7,13-15H2,1-6H3/t17-,18-/m0/s1 |
| InChIKey | CFUNYQNGXXHCEF-ROUUACIJSA-N |
| XLogP | 5.16 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.50 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|