C24H39NO4Si — CID 14753722
ethyl 2-[(2S,3S,4S)-4-acetyl-1-benzyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrrolidin-3-yl]acetate (PubChem CID 14753722) has the molecular formula C24H39NO4Si and a molecular weight of 433.67 g/mol. Its IUPAC name is ethyl 2-[(2S,3S,4S)-4-acetyl-1-benzyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrrolidin-3-yl]acetate.
| Compound Name | ethyl 2-[(2S,3S,4S)-4-acetyl-1-benzyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrrolidin-3-yl]acetate |
|---|---|
| PubChem CID | 14753722 |
| Molecular Formula | C24H39NO4Si |
| Molecular Weight | 433.67 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | ethyl 2-[(2S,3S,4S)-4-acetyl-1-benzyl-2-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrrolidin-3-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1[C@@H](CO[Si](C)(C)C(C)(C)C)N(Cc2ccccc2)C[C@H]1C(C)=O |
| InChI | InChI=1S/C24H39NO4Si/c1-8-28-23(27)14-20-21(18(2)26)16-25(15-19-12-10-9-11-13-19)22(20)17-29-30(6,7)24(3,4)5/h9-13,20-22H,8,14-17H2,1-7H3/t20-,21-,22+/m0/s1 |
| InChIKey | DWACAKNUCVIOGE-FDFHNCONSA-N |
| XLogP | 4.67 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.67 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|