C19H25NO4 — CID 15890921
ethyl (2R)-2-[(3S,4S)-4-acetyl-5-oxo-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]propanoate (PubChem CID 15890921) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is ethyl (2R)-2-[(3S,4S)-4-acetyl-5-oxo-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]propanoate.
| Compound Name | ethyl (2R)-2-[(3S,4S)-4-acetyl-5-oxo-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 15890921 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | ethyl (2R)-2-[(3S,4S)-4-acetyl-5-oxo-1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]propanoate |
| SMILES | CCOC(=O)[C@H](C)[C@H]1CN([C@@H](C)c2ccccc2)C(=O)[C@@H]1C(C)=O |
| InChI | InChI=1S/C19H25NO4/c1-5-24-19(23)12(2)16-11-20(18(22)17(16)14(4)21)13(3)15-9-7-6-8-10-15/h6-10,12-13,16-17H,5,11H2,1-4H3/t12-,13+,16-,17-/m1/s1 |
| InChIKey | RMGQPTBMGKJCAG-DLTLXFJOSA-N |
| XLogP | 2.61 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|