C24H35NO3 — CID 143966203
cyclohexyl (1S)-6-[benzyl(methyl)carbamoyl]-5-ethylcyclohex-3-ene-1-carboxylate;molecular hydrogen (PubChem CID 143966203) has the molecular formula C24H35NO3 and a molecular weight of 385.55 g/mol. Its IUPAC name is cyclohexyl (1S)-6-[benzyl(methyl)carbamoyl]-5-ethylcyclohex-3-ene-1-carboxylate;molecular hydrogen.
| Compound Name | cyclohexyl (1S)-6-[benzyl(methyl)carbamoyl]-5-ethylcyclohex-3-ene-1-carboxylate;molecular hydrogen |
|---|---|
| PubChem CID | 143966203 |
| Molecular Formula | C24H35NO3 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.26 |
| IUPAC Name | cyclohexyl (1S)-6-[benzyl(methyl)carbamoyl]-5-ethylcyclohex-3-ene-1-carboxylate;molecular hydrogen |
| SMILES | CCC1C=CC[C@H](C(=O)OC2CCCCC2)C1C(=O)N(C)Cc1ccccc1.[H][H] |
| InChI | InChI=1S/C24H33NO3.H2/c1-3-19-13-10-16-21(24(27)28-20-14-8-5-9-15-20)22(19)23(26)25(2)17-18-11-6-4-7-12-18;/h4,6-7,10-13,19-22H,3,5,8-9,14-17H2,1-2H3;1H/t19?,21-,22?;/m0./s1 |
| InChIKey | UHZPBIOJBCPUNI-NQFDUEACSA-N |
| XLogP | 4.99 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|