C26H26FNO3 — CID 155675098
ethyl 4-[1-benzyl-5-fluoro-2-oxo-4-[(E)-2-phenylethenyl]-3-pyridinyl]butanoate (PubChem CID 155675098) has the molecular formula C26H26FNO3 and a molecular weight of 419.50 g/mol. Its IUPAC name is ethyl 4-[1-benzyl-5-fluoro-2-oxo-4-[(E)-2-phenylethenyl]-3-pyridinyl]butanoate.
| Compound Name | ethyl 4-[1-benzyl-5-fluoro-2-oxo-4-[(E)-2-phenylethenyl]-3-pyridinyl]butanoate |
|---|---|
| PubChem CID | 155675098 |
| Molecular Formula | C26H26FNO3 |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | ethyl 4-[1-benzyl-5-fluoro-2-oxo-4-[(E)-2-phenylethenyl]-3-pyridinyl]butanoate |
| SMILES | CCOC(=O)CCCc1c(/C=C/c2ccccc2)c(F)cn(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C26H26FNO3/c1-2-31-25(29)15-9-14-23-22(17-16-20-10-5-3-6-11-20)24(27)19-28(26(23)30)18-21-12-7-4-8-13-21/h3-8,10-13,16-17,19H,2,9,14-15,18H2,1H3/b17-16+ |
| InChIKey | VCCCWTWDTYKGHU-WUKNDPDISA-N |
| XLogP | 5.09 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |