C37H67NO6Si3 — CID 11039805
(1S,2R,3S,7S,8S,9S,10R)-12-benzyl-2,8,9-tris[[tert-butyl(dimethyl)silyl]oxy]-5,5-dimethyl-4,6-dioxa-12-azatricyclo[8.2.1.03,7]tridecan-11-one (PubChem CID 11039805) has the molecular formula C37H67NO6Si3 and a molecular weight of 706.20 g/mol. Its IUPAC name is (1S,2R,3S,7S,8S,9S,10R)-12-benzyl-2,8,9-tris[[tert-butyl(dimethyl)silyl]oxy]-5,5-dimethyl-4,6-dioxa-12-azatricyclo[8.2.1.03,7]tridecan-11-one.
| Compound Name | (1S,2R,3S,7S,8S,9S,10R)-12-benzyl-2,8,9-tris[[tert-butyl(dimethyl)silyl]oxy]-5,5-dimethyl-4,6-dioxa-12-azatricyclo[8.2.1.03,7]tridecan-11-one |
|---|---|
| PubChem CID | 11039805 |
| Molecular Formula | C37H67NO6Si3 |
| Molecular Weight | 706.20 g/mol |
| Exact Mass | 705.43 |
| IUPAC Name | (1S,2R,3S,7S,8S,9S,10R)-12-benzyl-2,8,9-tris[[tert-butyl(dimethyl)silyl]oxy]-5,5-dimethyl-4,6-dioxa-12-azatricyclo[8.2.1.03,7]tridecan-11-one |
| SMILES | CC1(C)O[C@@H]2[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]3C[C@@H]([C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O1)N(Cc1ccccc1)C3=O |
| InChI | InChI=1S/C37H67NO6Si3/c1-34(2,3)45(12,13)42-28-26-23-27(38(33(26)39)24-25-21-19-18-20-22-25)29(43-46(14,15)35(4,5)6)30-31(41-37(10,11)40-30)32(28)44-47(16,17)36(7,8)9/h18-22,26-32H,23-24H2,1-17H3/t26-,27+,28+,29-,30-,31+,32-/m1/s1 |
| InChIKey | WSSRDWRBWXQDBU-WGQWQKRQSA-N |
| XLogP | 9.11 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.20 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|