C30H51NO5Si2 — CID 11827843
(1S,2R,3R,7R,8S,9R)-10-benzyl-2,8-bis[[tert-butyl(dimethyl)silyl]oxy]-5,5-dimethyl-4,6-dioxa-10-azatricyclo[7.2.1.03,7]dodecan-11-one (PubChem CID 11827843) has the molecular formula C30H51NO5Si2 and a molecular weight of 561.91 g/mol. Its IUPAC name is (1S,2R,3R,7R,8S,9R)-10-benzyl-2,8-bis[[tert-butyl(dimethyl)silyl]oxy]-5,5-dimethyl-4,6-dioxa-10-azatricyclo[7.2.1.03,7]dodecan-11-one.
| Compound Name | (1S,2R,3R,7R,8S,9R)-10-benzyl-2,8-bis[[tert-butyl(dimethyl)silyl]oxy]-5,5-dimethyl-4,6-dioxa-10-azatricyclo[7.2.1.03,7]dodecan-11-one |
|---|---|
| PubChem CID | 11827843 |
| Molecular Formula | C30H51NO5Si2 |
| Molecular Weight | 561.91 g/mol |
| Exact Mass | 561.33 |
| IUPAC Name | (1S,2R,3R,7R,8S,9R)-10-benzyl-2,8-bis[[tert-butyl(dimethyl)silyl]oxy]-5,5-dimethyl-4,6-dioxa-10-azatricyclo[7.2.1.03,7]dodecan-11-one |
| SMILES | CC1(C)O[C@@H]2[C@@H](O1)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C[C@H]([C@@H]2O[Si](C)(C)C(C)(C)C)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C30H51NO5Si2/c1-28(2,3)37(9,10)35-23-21-18-22(31(27(21)32)19-20-16-14-13-15-17-20)24(36-38(11,12)29(4,5)6)26-25(23)33-30(7,8)34-26/h13-17,21-26H,18-19H2,1-12H3/t21-,22+,23+,24-,25-,26-/m0/s1 |
| InChIKey | QXGRVKRFTGBUGE-HGJFOVQVSA-N |
| XLogP | 6.72 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.91 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|