C14H26ClNO3Si — CID 102250859
(6R,8R)-6-[tert-butyl(dimethyl)silyl]oxy-2-chloro-8-hydroxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one (PubChem CID 102250859) has the molecular formula C14H26ClNO3Si and a molecular weight of 319.91 g/mol. Its IUPAC name is (6R,8R)-6-[tert-butyl(dimethyl)silyl]oxy-2-chloro-8-hydroxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one.
| Compound Name | (6R,8R)-6-[tert-butyl(dimethyl)silyl]oxy-2-chloro-8-hydroxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
|---|---|
| PubChem CID | 102250859 |
| Molecular Formula | C14H26ClNO3Si |
| Molecular Weight | 319.91 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | (6R,8R)-6-[tert-butyl(dimethyl)silyl]oxy-2-chloro-8-hydroxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@@H](O)C2CC(Cl)C(=O)N2C1 |
| InChI | InChI=1S/C14H26ClNO3Si/c1-14(2,3)20(4,5)19-9-6-12(17)11-7-10(15)13(18)16(11)8-9/h9-12,17H,6-8H2,1-5H3/t9-,10?,11?,12-/m1/s1 |
| InChIKey | OKDLLEIIJDCSON-HBIQZDMRSA-N |
| XLogP | 2.35 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.91 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|