C8H12ClNO2 — CID 10965289
(2R,8R,8aS)-2-chloro-8-hydroxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one (PubChem CID 10965289) has the molecular formula C8H12ClNO2 and a molecular weight of 189.64 g/mol. Its IUPAC name is (2R,8R,8aS)-2-chloro-8-hydroxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one.
| Compound Name | (2R,8R,8aS)-2-chloro-8-hydroxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
|---|---|
| PubChem CID | 10965289 |
| Molecular Formula | C8H12ClNO2 |
| Molecular Weight | 189.64 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | (2R,8R,8aS)-2-chloro-8-hydroxy-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
| SMILES | O=C1[C@H](Cl)C[C@H]2[C@H](O)CCCN12 |
| InChI | InChI=1S/C8H12ClNO2/c9-5-4-6-7(11)2-1-3-10(6)8(5)12/h5-7,11H,1-4H2/t5-,6+,7-/m1/s1 |
| InChIKey | NNLGZQINYMKCLL-DSYKOEDSSA-N |
| XLogP | 0.35 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.64 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|