C8H11ClN2O4 — CID 10998955
[(2S,8R,8aS)-2-chloro-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-8-yl] nitrate (PubChem CID 10998955) has the molecular formula C8H11ClN2O4 and a molecular weight of 234.64 g/mol. Its IUPAC name is [(2S,8R,8aS)-2-chloro-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-8-yl] nitrate.
| Compound Name | [(2S,8R,8aS)-2-chloro-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-8-yl] nitrate |
|---|---|
| PubChem CID | 10998955 |
| Molecular Formula | C8H11ClN2O4 |
| Molecular Weight | 234.64 g/mol |
| Exact Mass | 234.04 |
| IUPAC Name | [(2S,8R,8aS)-2-chloro-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-8-yl] nitrate |
| SMILES | O=C1[C@@H](Cl)C[C@H]2[C@H](O[N+](=O)[O-])CCCN12 |
| InChI | InChI=1S/C8H11ClN2O4/c9-5-4-6-7(15-11(13)14)2-1-3-10(6)8(5)12/h5-7H,1-4H2/t5-,6-,7+/m0/s1 |
| InChIKey | AXVNSKKDNUTNTM-LYFYHCNISA-N |
| XLogP | 0.57 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.64 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|