C20H31NO3Si — CID 102250861
(2R,6S,8R)-2-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-6-phenyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one (PubChem CID 102250861) has the molecular formula C20H31NO3Si and a molecular weight of 361.56 g/mol. Its IUPAC name is (2R,6S,8R)-2-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-6-phenyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one.
| Compound Name | (2R,6S,8R)-2-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-6-phenyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 102250861 |
| Molecular Formula | C20H31NO3Si |
| Molecular Weight | 361.56 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | (2R,6S,8R)-2-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-6-phenyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC2[C@H](O)C[C@@H](c3ccccc3)C(=O)N2C1 |
| InChI | InChI=1S/C20H31NO3Si/c1-20(2,3)25(4,5)24-15-11-17-18(22)12-16(19(23)21(17)13-15)14-9-7-6-8-10-14/h6-10,15-18,22H,11-13H2,1-5H3/t15-,16+,17?,18-/m1/s1 |
| InChIKey | AMNODLWXDPIHBK-UJJTZGENSA-N |
| XLogP | 3.53 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.56 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|