C20H30BrNO2Si — CID 10574339
(2R,6S,8R,8aS)-8-bromo-2-[tert-butyl(dimethyl)silyl]oxy-6-phenyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one (PubChem CID 10574339) has the molecular formula C20H30BrNO2Si and a molecular weight of 424.46 g/mol. Its IUPAC name is (2R,6S,8R,8aS)-8-bromo-2-[tert-butyl(dimethyl)silyl]oxy-6-phenyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one.
| Compound Name | (2R,6S,8R,8aS)-8-bromo-2-[tert-butyl(dimethyl)silyl]oxy-6-phenyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 10574339 |
| Molecular Formula | C20H30BrNO2Si |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | (2R,6S,8R,8aS)-8-bromo-2-[tert-butyl(dimethyl)silyl]oxy-6-phenyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@H]2[C@H](Br)C[C@@H](c3ccccc3)C(=O)N2C1 |
| InChI | InChI=1S/C20H30BrNO2Si/c1-20(2,3)25(4,5)24-15-11-18-17(21)12-16(19(23)22(18)13-15)14-9-7-6-8-10-14/h6-10,15-18H,11-13H2,1-5H3/t15-,16+,17-,18+/m1/s1 |
| InChIKey | RPVBDRLBGUYVTN-XDNAFOTISA-N |
| XLogP | 4.93 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|