C26H35NO2SeSi — CID 11799555
(2S,6R,8R,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-8-phenylselanyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one (PubChem CID 11799555) has the molecular formula C26H35NO2SeSi and a molecular weight of 500.62 g/mol. Its IUPAC name is (2S,6R,8R,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-8-phenylselanyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one.
| Compound Name | (2S,6R,8R,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-8-phenylselanyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
|---|---|
| PubChem CID | 11799555 |
| Molecular Formula | C26H35NO2SeSi |
| Molecular Weight | 500.62 g/mol |
| Exact Mass | 501.16 |
| IUPAC Name | (2S,6R,8R,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-2-phenyl-8-phenylselanyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-3-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@@H]([Se]c2ccccc2)[C@@H]2C[C@@H](c3ccccc3)C(=O)N2C1 |
| InChI | InChI=1S/C26H35NO2SeSi/c1-26(2,3)31(4,5)29-20-16-24(30-21-14-10-7-11-15-21)23-17-22(25(28)27(23)18-20)19-12-8-6-9-13-19/h6-15,20,22-24H,16-18H2,1-5H3/t20-,22+,23+,24-/m1/s1 |
| InChIKey | HSVHNXUVMQSYSG-AYVPJYCDSA-N |
| XLogP | 4.98 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.62 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|