C33H48N2O2Si — CID 91208420
7-[2-[3-[tert-butyl(dimethyl)silyl]oxy-1-(4-phenylphenyl)butyl]-5-oxopyrrolidin-1-yl]heptanenitrile (PubChem CID 91208420) has the molecular formula C33H48N2O2Si and a molecular weight of 532.85 g/mol. Its IUPAC name is 7-[2-[3-[tert-butyl(dimethyl)silyl]oxy-1-(4-phenylphenyl)butyl]-5-oxopyrrolidin-1-yl]heptanenitrile.
| Compound Name | 7-[2-[3-[tert-butyl(dimethyl)silyl]oxy-1-(4-phenylphenyl)butyl]-5-oxopyrrolidin-1-yl]heptanenitrile |
|---|---|
| PubChem CID | 91208420 |
| Molecular Formula | C33H48N2O2Si |
| Molecular Weight | 532.85 g/mol |
| Exact Mass | 532.35 |
| IUPAC Name | 7-[2-[3-[tert-butyl(dimethyl)silyl]oxy-1-(4-phenylphenyl)butyl]-5-oxopyrrolidin-1-yl]heptanenitrile |
| SMILES | CC(CC(c1ccc(-c2ccccc2)cc1)C1CCC(=O)N1CCCCCCC#N)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H48N2O2Si/c1-26(37-38(5,6)33(2,3)4)25-30(29-19-17-28(18-20-29)27-15-11-10-12-16-27)31-21-22-32(36)35(31)24-14-9-7-8-13-23-34/h10-12,15-20,26,30-31H,7-9,13-14,21-22,24-25H2,1-6H3 |
| InChIKey | SABCVIMXRZMWLZ-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.85 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|