C22H37NO2Si — CID 138981267
(5S)-5-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-5-phenylpentyl]-1-methylpyrrolidin-2-one (PubChem CID 138981267) has the molecular formula C22H37NO2Si and a molecular weight of 375.63 g/mol. Its IUPAC name is (5S)-5-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-5-phenylpentyl]-1-methylpyrrolidin-2-one.
| Compound Name | (5S)-5-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-5-phenylpentyl]-1-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 138981267 |
| Molecular Formula | C22H37NO2Si |
| Molecular Weight | 375.63 g/mol |
| Exact Mass | 375.26 |
| IUPAC Name | (5S)-5-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-5-phenylpentyl]-1-methylpyrrolidin-2-one |
| SMILES | CN1C(=O)CC[C@H]1C[C@@H](CCCc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H37NO2Si/c1-22(2,3)26(5,6)25-20(17-19-15-16-21(24)23(19)4)14-10-13-18-11-8-7-9-12-18/h7-9,11-12,19-20H,10,13-17H2,1-6H3/t19-,20+/m0/s1 |
| InChIKey | NINMBKQXWKEZIM-VQTJNVASSA-N |
| XLogP | 5.41 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.63 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|