C24H33NO2Si — CID 67802008
3-methyl-5-[(4-phenylphenyl)methyl]-1-(2-trimethylsilylethoxymethyl)pyrrolidin-2-one (PubChem CID 67802008) has the molecular formula C24H33NO2Si and a molecular weight of 395.62 g/mol. Its IUPAC name is 3-methyl-5-[(4-phenylphenyl)methyl]-1-(2-trimethylsilylethoxymethyl)pyrrolidin-2-one.
| Compound Name | 3-methyl-5-[(4-phenylphenyl)methyl]-1-(2-trimethylsilylethoxymethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 67802008 |
| Molecular Formula | C24H33NO2Si |
| Molecular Weight | 395.62 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | 3-methyl-5-[(4-phenylphenyl)methyl]-1-(2-trimethylsilylethoxymethyl)pyrrolidin-2-one |
| SMILES | CC1CC(Cc2ccc(-c3ccccc3)cc2)N(COCC[Si](C)(C)C)C1=O |
| InChI | InChI=1S/C24H33NO2Si/c1-19-16-23(25(24(19)26)18-27-14-15-28(2,3)4)17-20-10-12-22(13-11-20)21-8-6-5-7-9-21/h5-13,19,23H,14-18H2,1-4H3 |
| InChIKey | HBSBPABHBKMHJW-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.62 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|