C29H37NO3Si — CID 139115158
(4R)-4-benzyl-3-[(1S,2S,5S,6R)-5,6-dimethyl-2-phenyl-4-(trimethylsilylmethyl)cyclohex-3-ene-1-carbonyl]-1,3-oxazolidin-2-one (PubChem CID 139115158) has the molecular formula C29H37NO3Si and a molecular weight of 475.71 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(1S,2S,5S,6R)-5,6-dimethyl-2-phenyl-4-(trimethylsilylmethyl)cyclohex-3-ene-1-carbonyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(1S,2S,5S,6R)-5,6-dimethyl-2-phenyl-4-(trimethylsilylmethyl)cyclohex-3-ene-1-carbonyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 139115158 |
| Molecular Formula | C29H37NO3Si |
| Molecular Weight | 475.71 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | (4R)-4-benzyl-3-[(1S,2S,5S,6R)-5,6-dimethyl-2-phenyl-4-(trimethylsilylmethyl)cyclohex-3-ene-1-carbonyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@H]1[C@H](C(=O)N2C(=O)OC[C@H]2Cc2ccccc2)[C@@H](c2ccccc2)C=C(C[Si](C)(C)C)[C@H]1C |
| InChI | InChI=1S/C29H37NO3Si/c1-20-21(2)27(26(23-14-10-7-11-15-23)17-24(20)19-34(3,4)5)28(31)30-25(18-33-29(30)32)16-22-12-8-6-9-13-22/h6-15,17,20-21,25-27H,16,18-19H2,1-5H3/t20-,21+,25+,26+,27-/m0/s1 |
| InChIKey | NMFCSYZZLGXDIW-LQEJYONJSA-N |
| XLogP | 6.53 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.71 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|