C20H28O5 — CID 102251003
(4aS,6S,10aR,11R,11aR,11bR)-6,10a,11-trihydroxy-4,4,8,11b-tetramethyl-1,2,3,4a,5,6,11,11a-octahydronaphtho[2,1-f][1]benzofuran-9-one (PubChem CID 102251003) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is (4aS,6S,10aR,11R,11aR,11bR)-6,10a,11-trihydroxy-4,4,8,11b-tetramethyl-1,2,3,4a,5,6,11,11a-octahydronaphtho[2,1-f][1]benzofuran-9-one.
| Compound Name | (4aS,6S,10aR,11R,11aR,11bR)-6,10a,11-trihydroxy-4,4,8,11b-tetramethyl-1,2,3,4a,5,6,11,11a-octahydronaphtho[2,1-f][1]benzofuran-9-one |
|---|---|
| PubChem CID | 102251003 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | (4aS,6S,10aR,11R,11aR,11bR)-6,10a,11-trihydroxy-4,4,8,11b-tetramethyl-1,2,3,4a,5,6,11,11a-octahydronaphtho[2,1-f][1]benzofuran-9-one |
| SMILES | CC1=C2C=C3[C@H]([C@@H](O)[C@]2(O)OC1=O)[C@]1(C)CCCC(C)(C)[C@@H]1C[C@@H]3O |
| InChI | InChI=1S/C20H28O5/c1-10-12-8-11-13(21)9-14-18(2,3)6-5-7-19(14,4)15(11)16(22)20(12,24)25-17(10)23/h8,13-16,21-22,24H,5-7,9H2,1-4H3/t13-,14-,15+,16+,19+,20+/m0/s1 |
| InChIKey | STNYLQGVPSNGGH-MBLGUKAXSA-N |
| XLogP | 2.06 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |