C13H16INO4S — CID 102251807
methyl (Z)-4-iodo-3-[methanesulfonamido(phenyl)methyl]but-3-enoate (PubChem CID 102251807) has the molecular formula C13H16INO4S and a molecular weight of 409.25 g/mol. Its IUPAC name is methyl (Z)-4-iodo-3-[methanesulfonamido(phenyl)methyl]but-3-enoate.
| Compound Name | methyl (Z)-4-iodo-3-[methanesulfonamido(phenyl)methyl]but-3-enoate |
|---|---|
| PubChem CID | 102251807 |
| Molecular Formula | C13H16INO4S |
| Molecular Weight | 409.25 g/mol |
| Exact Mass | 408.98 |
| IUPAC Name | methyl (Z)-4-iodo-3-[methanesulfonamido(phenyl)methyl]but-3-enoate |
| SMILES | COC(=O)C/C(=C/I)C(NS(C)(=O)=O)c1ccccc1 |
| InChI | InChI=1S/C13H16INO4S/c1-19-12(16)8-11(9-14)13(15-20(2,17)18)10-6-4-3-5-7-10/h3-7,9,13,15H,8H2,1-2H3/b11-9- |
| InChIKey | HCNBMXLLPZPIKP-LUAWRHEFSA-N |
| XLogP | 2.16 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.25 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|