C19H25N3O10 — CID 102252693
(4aR,6S,7R,8R,8aS)-6-[(2R,3S,4R,5R,6R)-6-azido-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol (PubChem CID 102252693) has the molecular formula C19H25N3O10 and a molecular weight of 455.42 g/mol. Its IUPAC name is (4aR,6S,7R,8R,8aS)-6-[(2R,3S,4R,5R,6R)-6-azido-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol.
| Compound Name | (4aR,6S,7R,8R,8aS)-6-[(2R,3S,4R,5R,6R)-6-azido-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
|---|---|
| PubChem CID | 102252693 |
| Molecular Formula | C19H25N3O10 |
| Molecular Weight | 455.42 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | (4aR,6S,7R,8R,8aS)-6-[(2R,3S,4R,5R,6R)-6-azido-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
| SMILES | [N-]=[N+]=N[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@@H]3COC(c4ccccc4)O[C@H]3[C@H](O)[C@H]2O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C19H25N3O10/c20-22-21-17-13(26)11(24)15(9(6-23)29-17)32-19-14(27)12(25)16-10(30-19)7-28-18(31-16)8-4-2-1-3-5-8/h1-5,9-19,23-27H,6-7H2/t9-,10-,11-,12-,13-,14-,15-,16-,17-,18?,19+/m1/s1 |
| InChIKey | VHRMHVUBITTYCW-AYMRMQDYSA-N |
| XLogP | -1.32 |
| TPSA | 196.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.42 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|