C17H31F3O2Si — CID 102253975
(1S)-1-[tert-butyl(dimethyl)silyl]oxy-1-cyclohexyl-4,4,4-trifluoro-3-methylbutan-2-one (PubChem CID 102253975) has the molecular formula C17H31F3O2Si and a molecular weight of 352.51 g/mol. Its IUPAC name is (1S)-1-[tert-butyl(dimethyl)silyl]oxy-1-cyclohexyl-4,4,4-trifluoro-3-methylbutan-2-one.
| Compound Name | (1S)-1-[tert-butyl(dimethyl)silyl]oxy-1-cyclohexyl-4,4,4-trifluoro-3-methylbutan-2-one |
|---|---|
| PubChem CID | 102253975 |
| Molecular Formula | C17H31F3O2Si |
| Molecular Weight | 352.51 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | (1S)-1-[tert-butyl(dimethyl)silyl]oxy-1-cyclohexyl-4,4,4-trifluoro-3-methylbutan-2-one |
| SMILES | CC(C(=O)[C@@H](O[Si](C)(C)C(C)(C)C)C1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C17H31F3O2Si/c1-12(17(18,19)20)14(21)15(13-10-8-7-9-11-13)22-23(5,6)16(2,3)4/h12-13,15H,7-11H2,1-6H3/t12?,15-/m0/s1 |
| InChIKey | SVHUYSQYAPSZMO-CVRLYYSRSA-N |
| XLogP | 5.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.51 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|