C17H33F3O3Si2 — CID 150817053
(1R)-1-[tert-butylsilyloxy(dimethyl)silyl]oxy-1-cyclohexyl-4,4,4-trifluoro-3-methylbutan-2-one (PubChem CID 150817053) has the molecular formula C17H33F3O3Si2 and a molecular weight of 398.61 g/mol. Its IUPAC name is (1R)-1-[tert-butylsilyloxy(dimethyl)silyl]oxy-1-cyclohexyl-4,4,4-trifluoro-3-methylbutan-2-one.
| Compound Name | (1R)-1-[tert-butylsilyloxy(dimethyl)silyl]oxy-1-cyclohexyl-4,4,4-trifluoro-3-methylbutan-2-one |
|---|---|
| PubChem CID | 150817053 |
| Molecular Formula | C17H33F3O3Si2 |
| Molecular Weight | 398.61 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | (1R)-1-[tert-butylsilyloxy(dimethyl)silyl]oxy-1-cyclohexyl-4,4,4-trifluoro-3-methylbutan-2-one |
| SMILES | CC(C(=O)[C@H](O[Si](C)(C)O[SiH2]C(C)(C)C)C1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C17H33F3O3Si2/c1-12(17(18,19)20)14(21)15(13-10-8-7-9-11-13)22-25(5,6)23-24-16(2,3)4/h12-13,15H,7-11,24H2,1-6H3/t12?,15-/m1/s1 |
| InChIKey | KJCOVWBLDCWPKQ-WPZCJLIBSA-N |
| XLogP | 4.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.61 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|