C20H28O2 — CID 102254404
(1R,2R,5R,9E,11S,12S)-1,5,9-trimethyl-12-prop-1-en-2-yl-15-oxatricyclo[10.2.1.02,11]pentadeca-9,13-dien-6-one (PubChem CID 102254404) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is (1R,2R,5R,9E,11S,12S)-1,5,9-trimethyl-12-prop-1-en-2-yl-15-oxatricyclo[10.2.1.02,11]pentadeca-9,13-dien-6-one.
| Compound Name | (1R,2R,5R,9E,11S,12S)-1,5,9-trimethyl-12-prop-1-en-2-yl-15-oxatricyclo[10.2.1.02,11]pentadeca-9,13-dien-6-one |
|---|---|
| PubChem CID | 102254404 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | (1R,2R,5R,9E,11S,12S)-1,5,9-trimethyl-12-prop-1-en-2-yl-15-oxatricyclo[10.2.1.02,11]pentadeca-9,13-dien-6-one |
| SMILES | C=C(C)[C@@]12C=C[C@@](C)(O1)[C@@H]1CC[C@@H](C)C(=O)CC/C(C)=C/[C@@H]12 |
| InChI | InChI=1S/C20H28O2/c1-13(2)20-11-10-19(5,22-20)16-8-7-15(4)18(21)9-6-14(3)12-17(16)20/h10-12,15-17H,1,6-9H2,2-5H3/b14-12+/t15-,16-,17+,19-,20-/m1/s1 |
| InChIKey | OUMQMOGVZAXEAE-ACSQGDIBSA-N |
| XLogP | 4.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|