C15H23NO3 — CID 102254657
tert-butyl N-methyl-N-[(1R,2S)-2-prop-2-ynoylcyclohexyl]carbamate (PubChem CID 102254657) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[(1R,2S)-2-prop-2-ynoylcyclohexyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[(1R,2S)-2-prop-2-ynoylcyclohexyl]carbamate |
|---|---|
| PubChem CID | 102254657 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | tert-butyl N-methyl-N-[(1R,2S)-2-prop-2-ynoylcyclohexyl]carbamate |
| SMILES | C#CC(=O)[C@H]1CCCC[C@H]1N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H23NO3/c1-6-13(17)11-9-7-8-10-12(11)16(5)14(18)19-15(2,3)4/h1,11-12H,7-10H2,2-5H3/t11-,12+/m0/s1 |
| InChIKey | PWJGGGYOQRWJLC-NWDGAFQWSA-N |
| XLogP | 2.61 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|