C12H21F2NO2 — CID 154432366
tert-butyl N-(3,3-difluorocyclohexyl)-N-methylcarbamate (PubChem CID 154432366) has the molecular formula C12H21F2NO2 and a molecular weight of 249.30 g/mol. Its IUPAC name is tert-butyl N-(3,3-difluorocyclohexyl)-N-methylcarbamate.
| Compound Name | tert-butyl N-(3,3-difluorocyclohexyl)-N-methylcarbamate |
|---|---|
| PubChem CID | 154432366 |
| Molecular Formula | C12H21F2NO2 |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | tert-butyl N-(3,3-difluorocyclohexyl)-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)C1CCCC(F)(F)C1 |
| InChI | InChI=1S/C12H21F2NO2/c1-11(2,3)17-10(16)15(4)9-6-5-7-12(13,14)8-9/h9H,5-8H2,1-4H3 |
| InChIKey | LQZAKUSNKKQFRK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |