C12H24N2O4S — CID 154068887
tert-butyl N-methyl-N-(1-methylsulfonylpiperidin-3-yl)carbamate (PubChem CID 154068887) has the molecular formula C12H24N2O4S and a molecular weight of 292.40 g/mol. Its IUPAC name is tert-butyl N-methyl-N-(1-methylsulfonylpiperidin-3-yl)carbamate.
| Compound Name | tert-butyl N-methyl-N-(1-methylsulfonylpiperidin-3-yl)carbamate |
|---|---|
| PubChem CID | 154068887 |
| Molecular Formula | C12H24N2O4S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | tert-butyl N-methyl-N-(1-methylsulfonylpiperidin-3-yl)carbamate |
| SMILES | CN(C(=O)OC(C)(C)C)C1CCCN(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C12H24N2O4S/c1-12(2,3)18-11(15)13(4)10-7-6-8-14(9-10)19(5,16)17/h10H,6-9H2,1-5H3 |
| InChIKey | FMVXYLQJTJPTPJ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |