C17H29N3O2 — CID 97175579
tert-butyl N-methyl-N-[(3S)-1-[(1S)-1-(1H-pyrrol-2-yl)ethyl]piperidin-3-yl]carbamate (PubChem CID 97175579) has the molecular formula C17H29N3O2 and a molecular weight of 307.44 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[(3S)-1-[(1S)-1-(1H-pyrrol-2-yl)ethyl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[(3S)-1-[(1S)-1-(1H-pyrrol-2-yl)ethyl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 97175579 |
| Molecular Formula | C17H29N3O2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | tert-butyl N-methyl-N-[(3S)-1-[(1S)-1-(1H-pyrrol-2-yl)ethyl]piperidin-3-yl]carbamate |
| SMILES | C[C@@H](c1ccc[nH]1)N1CCC[C@H](N(C)C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C17H29N3O2/c1-13(15-9-6-10-18-15)20-11-7-8-14(12-20)19(5)16(21)22-17(2,3)4/h6,9-10,13-14,18H,7-8,11-12H2,1-5H3/t13-,14-/m0/s1 |
| InChIKey | HHFBCIXWGMQFIQ-KBPBESRZSA-N |
| XLogP | 3.41 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |