C17H29N3O2 — CID 98084269
tert-butyl N-[[(3S)-1-[(1S)-1-(1H-pyrrol-2-yl)ethyl]piperidin-3-yl]methyl]carbamate (PubChem CID 98084269) has the molecular formula C17H29N3O2 and a molecular weight of 307.44 g/mol. Its IUPAC name is tert-butyl N-[[(3S)-1-[(1S)-1-(1H-pyrrol-2-yl)ethyl]piperidin-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(3S)-1-[(1S)-1-(1H-pyrrol-2-yl)ethyl]piperidin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 98084269 |
| Molecular Formula | C17H29N3O2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | tert-butyl N-[[(3S)-1-[(1S)-1-(1H-pyrrol-2-yl)ethyl]piperidin-3-yl]methyl]carbamate |
| SMILES | C[C@@H](c1ccc[nH]1)N1CCC[C@@H](CNC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C17H29N3O2/c1-13(15-8-5-9-18-15)20-10-6-7-14(12-20)11-19-16(21)22-17(2,3)4/h5,8-9,13-14,18H,6-7,10-12H2,1-4H3,(H,19,21)/t13-,14-/m0/s1 |
| InChIKey | WRHTYBYRDPHKIU-KBPBESRZSA-N |
| XLogP | 3.31 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |